About 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene
5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene (PubChem CID 143194650) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene |
| PubChem CID | 143194650 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene |
| SMILES | C/C=C(\C=C/CC)CCC1C=CC=C1 |
| InChI | InChI=1S/C14H20/c1-3-5-8-13(4-2)11-12-14-9-6-7-10-14/h4-10,14H,3,11-12H2,1-2H3/b8-5-,13-4+ |
| InChIKey | MRRODYFEFREYMK-RPMRFSCESA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene?
The IUPAC name of 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene (CID 143194650) is 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene.
What is the SMILES notation for 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene?
The canonical SMILES for 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene is C/C=C(\C=C/CC)CCC1C=CC=C1.
What is the InChIKey of 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene?
The InChIKey is MRRODYFEFREYMK-RPMRFSCESA-N. The full InChI is InChI=1S/C14H20/c1-3-5-8-13(4-2)11-12-14-9-6-7-10-14/h4-10,14H,3,11-12H2,1-2H3/b8-5-,13-4+.
What are the key properties of 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene?
5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene has a molecular weight of 188.31 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z,3Z)-3-ethylidenehept-4-enyl]cyclopenta-1,3-diene is sourced from PubChem (CID 143194650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).