C12H19NO — CID 143195163
2-[5-[(1E,3Z)-hexa-1,3,5-trienyl]oxolan-2-yl]ethanamine (PubChem CID 143195163) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[5-[(1E,3Z)-hexa-1,3,5-trienyl]oxolan-2-yl]ethanamine.
| Compound Name | 2-[5-[(1E,3Z)-hexa-1,3,5-trienyl]oxolan-2-yl]ethanamine |
|---|---|
| PubChem CID | 143195163 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[5-[(1E,3Z)-hexa-1,3,5-trienyl]oxolan-2-yl]ethanamine |
| SMILES | C=C/C=C\C=C\C1CCC(CCN)O1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-6-11-7-8-12(14-11)9-10-13/h2-6,11-12H,1,7-10,13H2/b4-3-,6-5+ |
| InChIKey | HNAWVDCMOWXZBE-DNVGVPOPSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|