About 2-aminobutanal;methoxymethane
2-aminobutanal;methoxymethane (PubChem CID 143195506) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-aminobutanal;methoxymethane.
Molecular Properties
| Compound Name | 2-aminobutanal;methoxymethane |
| PubChem CID | 143195506 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-aminobutanal;methoxymethane |
| SMILES | CCC(N)C=O.COC |
| InChI | InChI=1S/C4H9NO.C2H6O/c1-2-4(5)3-6;1-3-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | LFCJFKKPQRNMOG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutanal;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanal;methoxymethane?
The IUPAC name of 2-aminobutanal;methoxymethane (CID 143195506) is 2-aminobutanal;methoxymethane.
What is the SMILES notation for 2-aminobutanal;methoxymethane?
The canonical SMILES for 2-aminobutanal;methoxymethane is CCC(N)C=O.COC.
What is the InChIKey of 2-aminobutanal;methoxymethane?
The InChIKey is LFCJFKKPQRNMOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2H6O/c1-2-4(5)3-6;1-3-2/h3-4H,2,5H2,1H3;1-2H3.
What are the key properties of 2-aminobutanal;methoxymethane?
2-aminobutanal;methoxymethane has a molecular weight of 133.19 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanal;methoxymethane is sourced from PubChem (CID 143195506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).