About ethane;1,2,6,7-tetrahydroquinazoline
ethane;1,2,6,7-tetrahydroquinazoline (PubChem CID 143195739) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;1,2,6,7-tetrahydroquinazoline.
Molecular Properties
| Compound Name | ethane;1,2,6,7-tetrahydroquinazoline |
| PubChem CID | 143195739 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethane;1,2,6,7-tetrahydroquinazoline |
| SMILES | C1=NCNC2=CCCC=C12.CC |
| InChI | InChI=1S/C8H10N2.C2H6/c1-2-4-8-7(3-1)5-9-6-10-8;1-2/h3-5,10H,1-2,6H2;1-2H3 |
| InChIKey | JUBZEBODHHREFS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1,2,6,7-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,2,6,7-tetrahydroquinazoline?
The IUPAC name of ethane;1,2,6,7-tetrahydroquinazoline (CID 143195739) is ethane;1,2,6,7-tetrahydroquinazoline.
What is the SMILES notation for ethane;1,2,6,7-tetrahydroquinazoline?
The canonical SMILES for ethane;1,2,6,7-tetrahydroquinazoline is C1=NCNC2=CCCC=C12.CC.
What is the InChIKey of ethane;1,2,6,7-tetrahydroquinazoline?
The InChIKey is JUBZEBODHHREFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C2H6/c1-2-4-8-7(3-1)5-9-6-10-8;1-2/h3-5,10H,1-2,6H2;1-2H3.
What are the key properties of ethane;1,2,6,7-tetrahydroquinazoline?
ethane;1,2,6,7-tetrahydroquinazoline has a molecular weight of 164.25 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,2,6,7-tetrahydroquinazoline is sourced from PubChem (CID 143195739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).