About (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine
(2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine (PubChem CID 143195765) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine.
Molecular Properties
| Compound Name | (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine |
| PubChem CID | 143195765 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine |
| SMILES | C=C/C=C1/NC=CO/C1=C/CC |
| InChI | InChI=1S/C10H13NO/c1-3-5-9-10(6-4-2)12-8-7-11-9/h3,5-8,11H,1,4H2,2H3/b9-5+,10-6+ |
| InChIKey | ISLSPRRNQWYPQM-NXZHAISVSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine?
The IUPAC name of (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine (CID 143195765) is (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine.
What is the SMILES notation for (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine?
The canonical SMILES for (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine is C=C/C=C1/NC=CO/C1=C/CC.
What is the InChIKey of (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine?
The InChIKey is ISLSPRRNQWYPQM-NXZHAISVSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-5-9-10(6-4-2)12-8-7-11-9/h3,5-8,11H,1,4H2,2H3/b9-5+,10-6+.
What are the key properties of (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine?
(2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine has a molecular weight of 163.22 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-3-prop-2-enylidene-2-propylidene-4H-1,4-oxazine is sourced from PubChem (CID 143195765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).