C19H30N2O2 — CID 143196277
N-hexyl-3-phenylpropanamide;N-prop-2-enylformamide (PubChem CID 143196277) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-hexyl-3-phenylpropanamide;N-prop-2-enylformamide.
| Compound Name | N-hexyl-3-phenylpropanamide;N-prop-2-enylformamide |
|---|---|
| PubChem CID | 143196277 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-hexyl-3-phenylpropanamide;N-prop-2-enylformamide |
| SMILES | C=CCNC=O.CCCCCCNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C15H23NO.C4H7NO/c1-2-3-4-8-13-16-15(17)12-11-14-9-6-5-7-10-14;1-2-3-5-4-6/h5-7,9-10H,2-4,8,11-13H2,1H3,(H,16,17);2,4H,1,3H2,(H,5,6) |
| InChIKey | DYVOZRZICJIFHC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|