About cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane
cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane (PubChem CID 143197062) has the molecular formula C18H29N5O2
and a molecular weight of 347.46 g/mol. Its IUPAC name is cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane.
Molecular Properties
| Compound Name | cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane |
| PubChem CID | 143197062 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane |
| SMILES | CC.CC(C)CN(NC(=O)OCC1CCCC1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C16H23N5O2.C2H6/c1-12(2)10-21(15-7-8-18-14(9-17)19-15)20-16(22)23-11-13-5-3-4-6-13;1-2/h7-8,12-13H,3-6,10-11H2,1-2H3,(H,20,22);1-2H3 |
| InChIKey | BDDSZBKVXGMGMY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane?
The IUPAC name of cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane (CID 143197062) is cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane.
What is the SMILES notation for cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane?
The canonical SMILES for cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane is CC.CC(C)CN(NC(=O)OCC1CCCC1)c1ccnc(C#N)n1.
What is the InChIKey of cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane?
The InChIKey is BDDSZBKVXGMGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O2.C2H6/c1-12(2)10-21(15-7-8-18-14(9-17)19-15)20-16(22)23-11-13-5-3-4-6-13;1-2/h7-8,12-13H,3-6,10-11H2,1-2H3,(H,20,22);1-2H3.
What are the key properties of cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane?
cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane has a molecular weight of 347.46 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;ethane is sourced from PubChem (CID 143197062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).