C23H27FN4O4S — CID 143197158
3-[(3-ethylsulfonylpyrrolidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 143197158) has the molecular formula C23H27FN4O4S and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[(3-ethylsulfonylpyrrolidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 3-[(3-ethylsulfonylpyrrolidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 143197158 |
| Molecular Formula | C23H27FN4O4S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[(3-ethylsulfonylpyrrolidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CCS(=O)(=O)C1CCN(Cc2cn(Cc3ccc(F)cc3)c3cnc(C(=O)N(C)O)cc23)C1 |
| InChI | InChI=1S/C23H27FN4O4S/c1-3-33(31,32)19-8-9-27(15-19)13-17-14-28(12-16-4-6-18(24)7-5-16)22-11-25-21(10-20(17)22)23(29)26(2)30/h4-7,10-11,14,19,30H,3,8-9,12-13,15H2,1-2H3 |
| InChIKey | HZQLQTXKFGRRHI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|