C23H23N2O7S3- — CID 143197263
(1E)-1-[2-(2-acetyloxyethyldisulfanyl)ethoxy]-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylmethanimidate (PubChem CID 143197263) has the molecular formula C23H23N2O7S3- and a molecular weight of 535.65 g/mol. Its IUPAC name is (1E)-1-[2-(2-acetyloxyethyldisulfanyl)ethoxy]-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylmethanimidate.
| Compound Name | (1E)-1-[2-(2-acetyloxyethyldisulfanyl)ethoxy]-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylmethanimidate |
|---|---|
| PubChem CID | 143197263 |
| Molecular Formula | C23H23N2O7S3- |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | (1E)-1-[2-(2-acetyloxyethyldisulfanyl)ethoxy]-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylmethanimidate |
| SMILES | CC(=O)OCCSSCCO/C([O-])=N/S(=O)(=O)c1ccc(-c2noc(C)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O7S3/c1-16-21(18-6-4-3-5-7-18)22(24-32-16)19-8-10-20(11-9-19)35(28,29)25-23(27)31-13-15-34-33-14-12-30-17(2)26/h3-11H,12-15H2,1-2H3,(H,25,27)/p-1 |
| InChIKey | YTUVXEUVAVIMHK-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 131.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|