C19H16ClF3N4OS — CID 143197562
4-[3-(5-amino-4-chlorocyclohexa-1,5-dien-1-yl)-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 143197562) has the molecular formula C19H16ClF3N4OS and a molecular weight of 440.88 g/mol. Its IUPAC name is 4-[3-(5-amino-4-chlorocyclohexa-1,5-dien-1-yl)-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(5-amino-4-chlorocyclohexa-1,5-dien-1-yl)-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 143197562 |
| Molecular Formula | C19H16ClF3N4OS |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-[3-(5-amino-4-chlorocyclohexa-1,5-dien-1-yl)-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1C1=CCC(Cl)C(N)=C1 |
| InChI | InChI=1S/C19H16ClF3N4OS/c1-18(2)16(28)26(11-4-3-10(9-24)13(7-11)19(21,22)23)17(29)27(18)12-5-6-14(20)15(25)8-12/h3-5,7-8,14H,6,25H2,1-2H3 |
| InChIKey | GSOAPZJGHRWZJG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|