C38H46FN5O3 — CID 143197937
ethanimine;5-(4-fluorophenyl)-4-methyl-1-[2-[(2S)-6-oxooxan-2-yl]ethyl]-N-phenyl-2-propan-2-ylpyrrole-3-carboxamide;N'-methyl-N-phenylmethanimidamide (PubChem CID 143197937) has the molecular formula C38H46FN5O3 and a molecular weight of 639.82 g/mol. Its IUPAC name is ethanimine;5-(4-fluorophenyl)-4-methyl-1-[2-[(2S)-6-oxooxan-2-yl]ethyl]-N-phenyl-2-propan-2-ylpyrrole-3-carboxamide;N'-methyl-N-phenylmethanimidamide.
| Compound Name | ethanimine;5-(4-fluorophenyl)-4-methyl-1-[2-[(2S)-6-oxooxan-2-yl]ethyl]-N-phenyl-2-propan-2-ylpyrrole-3-carboxamide;N'-methyl-N-phenylmethanimidamide |
|---|---|
| PubChem CID | 143197937 |
| Molecular Formula | C38H46FN5O3 |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | ethanimine;5-(4-fluorophenyl)-4-methyl-1-[2-[(2S)-6-oxooxan-2-yl]ethyl]-N-phenyl-2-propan-2-ylpyrrole-3-carboxamide;N'-methyl-N-phenylmethanimidamide |
| SMILES | C/N=C/Nc1ccccc1.Cc1c(C(=O)Nc2ccccc2)c(C(C)C)n(CC[C@@H]2CCCC(=O)O2)c1-c1ccc(F)cc1.[H]/N=C/C |
| InChI | InChI=1S/C28H31FN2O3.C8H10N2.C2H5N/c1-18(2)26-25(28(33)30-22-8-5-4-6-9-22)19(3)27(20-12-14-21(29)15-13-20)31(26)17-16-23-10-7-11-24(32)34-23;1-9-7-10-8-5-3-2-4-6-8;1-2-3/h4-6,8-9,12-15,18,23H,7,10-11,16-17H2,1-3H3,(H,30,33);2-7H,1H3,(H,9,10);2-3H,1H3/b;;3-2+/t23-;;/m0../s1 |
| InChIKey | GBGXJIVCGJEUOJ-IIDLGIMUSA-N |
| XLogP | 8.88 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|