About ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate
ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate (PubChem CID 143198463) has the molecular formula C17H31N3O2
and a molecular weight of 309.45 g/mol. Its IUPAC name is ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate.
Molecular Properties
| Compound Name | ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate |
| PubChem CID | 143198463 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate |
| SMILES | C=C/C=C(\CC=C)COC(=O)NCC1CCCNC1.CCN |
| InChI | InChI=1S/C15H24N2O2.C2H7N/c1-3-6-13(7-4-2)12-19-15(18)17-11-14-8-5-9-16-10-14;1-2-3/h3-4,6,14,16H,1-2,5,7-12H2,(H,17,18);2-3H2,1H3/b13-6+; |
| InChIKey | WYHRMURIRMUOQO-AWFSDRIXSA-N |
| XLogP | 2.37 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The IUPAC name of ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate (CID 143198463) is ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate.
What is the SMILES notation for ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The canonical SMILES for ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate is C=C/C=C(\CC=C)COC(=O)NCC1CCCNC1.CCN.
What is the InChIKey of ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The InChIKey is WYHRMURIRMUOQO-AWFSDRIXSA-N. The full InChI is InChI=1S/C15H24N2O2.C2H7N/c1-3-6-13(7-4-2)12-19-15(18)17-11-14-8-5-9-16-10-14;1-2-3/h3-4,6,14,16H,1-2,5,7-12H2,(H,17,18);2-3H2,1H3/b13-6+;.
What are the key properties of ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate has a molecular weight of 309.45 g/mol, XLogP of 2.37, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;[(2E)-2-prop-2-enylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate is sourced from PubChem (CID 143198463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).