C25H32N4O3 — CID 143198679
butan-1-ol;N-[[1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]methyl]formamide (PubChem CID 143198679) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is butan-1-ol;N-[[1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]methyl]formamide.
| Compound Name | butan-1-ol;N-[[1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 143198679 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | butan-1-ol;N-[[1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]methyl]formamide |
| SMILES | CCCCO.Cc1ccc2c(N3CCC(CNC=O)C3)nc(-c3ccccc3O)nc2c1 |
| InChI | InChI=1S/C21H22N4O2.C4H10O/c1-14-6-7-16-18(10-14)23-20(17-4-2-3-5-19(17)27)24-21(16)25-9-8-15(12-25)11-22-13-26;1-2-3-4-5/h2-7,10,13,15,27H,8-9,11-12H2,1H3,(H,22,26);5H,2-4H2,1H3 |
| InChIKey | QLMADKWISNWLQQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|