C23H34N4O — CID 143198686
4-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine;2-[(1-piperazin-1-ylethylideneamino)methyl]phenol (PubChem CID 143198686) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 4-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine;2-[(1-piperazin-1-ylethylideneamino)methyl]phenol.
| Compound Name | 4-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine;2-[(1-piperazin-1-ylethylideneamino)methyl]phenol |
|---|---|
| PubChem CID | 143198686 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 4-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine;2-[(1-piperazin-1-ylethylideneamino)methyl]phenol |
| SMILES | C/C(=N\Cc1ccccc1O)N1CCNCC1.CCC1=CC=CC(NC)=CC1 |
| InChI | InChI=1S/C13H19N3O.C10H15N/c1-11(16-8-6-14-7-9-16)15-10-12-4-2-3-5-13(12)17;1-3-9-5-4-6-10(11-2)8-7-9/h2-5,14,17H,6-10H2,1H3;4-6,8,11H,3,7H2,1-2H3/b15-11+; |
| InChIKey | XESAYYWUCIJAKQ-KRWCAOSLSA-N |
| XLogP | 3.60 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|