C28H32N4O3 — CID 143198730
[(2E,3Z)-2-ethylidenehexa-3,5-dienyl] carbamate;2-(7-methyl-4-pyrrolidin-1-ylquinazolin-2-yl)phenol (PubChem CID 143198730) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is [(2E,3Z)-2-ethylidenehexa-3,5-dienyl] carbamate;2-(7-methyl-4-pyrrolidin-1-ylquinazolin-2-yl)phenol.
| Compound Name | [(2E,3Z)-2-ethylidenehexa-3,5-dienyl] carbamate;2-(7-methyl-4-pyrrolidin-1-ylquinazolin-2-yl)phenol |
|---|---|
| PubChem CID | 143198730 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(2E,3Z)-2-ethylidenehexa-3,5-dienyl] carbamate;2-(7-methyl-4-pyrrolidin-1-ylquinazolin-2-yl)phenol |
| SMILES | C=C/C=C\C(=C/C)COC(N)=O.Cc1ccc2c(N3CCCC3)nc(-c3ccccc3O)nc2c1 |
| InChI | InChI=1S/C19H19N3O.C9H13NO2/c1-13-8-9-14-16(12-13)20-18(15-6-2-3-7-17(15)23)21-19(14)22-10-4-5-11-22;1-3-5-6-8(4-2)7-12-9(10)11/h2-3,6-9,12,23H,4-5,10-11H2,1H3;3-6H,1,7H2,2H3,(H2,10,11)/b;6-5-,8-4+ |
| InChIKey | IKTNVCACZYBQLA-WHYVDUFGSA-N |
| XLogP | 5.68 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|