C26H28ClN5O3S — CID 143198935
N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylsulfamoyl)benzamide;ethane (PubChem CID 143198935) has the molecular formula C26H28ClN5O3S and a molecular weight of 526.06 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylsulfamoyl)benzamide;ethane.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylsulfamoyl)benzamide;ethane |
|---|---|
| PubChem CID | 143198935 |
| Molecular Formula | C26H28ClN5O3S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylsulfamoyl)benzamide;ethane |
| SMILES | CC.O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(S(=O)(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C24H22ClN5O3S.C2H6/c25-22-10-7-19(16-21(22)23-4-1-2-11-27-23)29-24(31)18-5-8-20(9-6-18)34(32,33)28-12-3-14-30-15-13-26-17-30;1-2/h1-2,4-11,13,15-17,28H,3,12,14H2,(H,29,31);1-2H3 |
| InChIKey | ZFRQNDWHDSPLCI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|