C18H16NO+ — CID 143200260
4-methylidene-8-phenyl-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzoxazol-10-ium (PubChem CID 143200260) has the molecular formula C18H16NO+ and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-methylidene-8-phenyl-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzoxazol-10-ium.
| Compound Name | 4-methylidene-8-phenyl-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzoxazol-10-ium |
|---|---|
| PubChem CID | 143200260 |
| Molecular Formula | C18H16NO+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-methylidene-8-phenyl-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzoxazol-10-ium |
| SMILES | C=C1CCC[n+]2c1oc1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C18H16NO/c1-13-6-5-11-19-16-12-15(14-7-3-2-4-8-14)9-10-17(16)20-18(13)19/h2-4,7-10,12H,1,5-6,11H2/q+1 |
| InChIKey | ZWIVRHRCKFZDJS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|