About [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium
[(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium (PubChem CID 143200718) has the molecular formula C8H14NO3+
and a molecular weight of 172.20 g/mol. Its IUPAC name is [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium.
Molecular Properties
| Compound Name | [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium |
| PubChem CID | 143200718 |
| Molecular Formula | C8H14NO3+ |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium |
| SMILES | CC/C(C=COOOC)=C/C=[NH2+] |
| InChI | InChI=1S/C8H13NO3/c1-3-8(4-6-9)5-7-11-12-10-2/h4-7,9H,3H2,1-2H3/p+1/b7-5?,8-4-,9-6? |
| InChIKey | YXAFMEFOTYJSEZ-VKGMRPNKSA-O |
| XLogP | 0.18 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium?
The IUPAC name of [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium (CID 143200718) is [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium.
What is the SMILES notation for [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium?
The canonical SMILES for [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium is CC/C(C=COOOC)=C/C=[NH2+].
What is the InChIKey of [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium?
The InChIKey is YXAFMEFOTYJSEZ-VKGMRPNKSA-O. The full InChI is InChI=1S/C8H13NO3/c1-3-8(4-6-9)5-7-11-12-10-2/h4-7,9H,3H2,1-2H3/p+1/b7-5?,8-4-,9-6?.
What are the key properties of [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium?
[(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium has a molecular weight of 172.20 g/mol, XLogP of 0.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3-ethyl-5-methoxyperoxypenta-2,4-dienylidene]azanium is sourced from PubChem (CID 143200718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).