C11H13N3O2 — CID 143201117
6,9-dimethyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-6,8(12)-diene-2,10-dione (PubChem CID 143201117) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6,9-dimethyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-6,8(12)-diene-2,10-dione.
| Compound Name | 6,9-dimethyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-6,8(12)-diene-2,10-dione |
|---|---|
| PubChem CID | 143201117 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6,9-dimethyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-6,8(12)-diene-2,10-dione |
| SMILES | CC1=CC2=C3C(C1)NC(=O)N3CC(=O)N2C |
| InChI | InChI=1S/C11H13N3O2/c1-6-3-7-10-8(4-6)13(2)9(15)5-14(10)11(16)12-7/h4,7H,3,5H2,1-2H3,(H,12,16) |
| InChIKey | MPWQMUWJNWMECW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |