C23H24N2O3 — CID 143201282
ethane;N-(4-methyl-3-nitrophenyl)-2,2-diphenylacetamide (PubChem CID 143201282) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethane;N-(4-methyl-3-nitrophenyl)-2,2-diphenylacetamide.
| Compound Name | ethane;N-(4-methyl-3-nitrophenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 143201282 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethane;N-(4-methyl-3-nitrophenyl)-2,2-diphenylacetamide |
| SMILES | CC.Cc1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18N2O3.C2H6/c1-15-12-13-18(14-19(15)23(25)26)22-21(24)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-2/h2-14,20H,1H3,(H,22,24);1-2H3 |
| InChIKey | IJIFIVYOQIMKKO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|