C9H8F2O3 — CID 143201584
methyl (2Z)-4-fluoro-2-(1-fluoroethenyl)-3-formylpenta-2,4-dienoate (PubChem CID 143201584) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is methyl (2Z)-4-fluoro-2-(1-fluoroethenyl)-3-formylpenta-2,4-dienoate.
| Compound Name | methyl (2Z)-4-fluoro-2-(1-fluoroethenyl)-3-formylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 143201584 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | methyl (2Z)-4-fluoro-2-(1-fluoroethenyl)-3-formylpenta-2,4-dienoate |
| SMILES | C=C(F)/C(C=O)=C(\C(=C)F)C(=O)OC |
| InChI | InChI=1S/C9H8F2O3/c1-5(10)7(4-12)8(6(2)11)9(13)14-3/h4H,1-2H2,3H3/b8-7+ |
| InChIKey | PDDRPYGPGHSMHU-BQYQJAHWSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|