About ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine
ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine (PubChem CID 143202028) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine.
Molecular Properties
| Compound Name | ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine |
| PubChem CID | 143202028 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine |
| SMILES | C/C=C/CCN1CCOCC1.C/C=C\C[N+](=O)[O-].CC |
| InChI | InChI=1S/C9H17NO.C4H7NO2.C2H6/c1-2-3-4-5-10-6-8-11-9-7-10;1-2-3-4-5(6)7;1-2/h2-3H,4-9H2,1H3;2-3H,4H2,1H3;1-2H3/b3-2+;3-2-; |
| InChIKey | ANHYDACRMXUAKY-OLIZGRGESA-N |
| XLogP | 3.15 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine?
The IUPAC name of ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine (CID 143202028) is ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine.
What is the SMILES notation for ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine?
The canonical SMILES for ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine is C/C=C/CCN1CCOCC1.C/C=C\C[N+](=O)[O-].CC.
What is the InChIKey of ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine?
The InChIKey is ANHYDACRMXUAKY-OLIZGRGESA-N. The full InChI is InChI=1S/C9H17NO.C4H7NO2.C2H6/c1-2-3-4-5-10-6-8-11-9-7-10;1-2-3-4-5(6)7;1-2/h2-3H,4-9H2,1H3;2-3H,4H2,1H3;1-2H3/b3-2+;3-2-;.
What are the key properties of ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine?
ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine has a molecular weight of 286.42 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-1-nitrobut-2-ene;4-[(E)-pent-3-enyl]morpholine is sourced from PubChem (CID 143202028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).