About (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane
(3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane (PubChem CID 143202133) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane.
Molecular Properties
| Compound Name | (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane |
| PubChem CID | 143202133 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane |
| SMILES | C=C(O)/C=C\C(=C)C(C)C.CC1CO1 |
| InChI | InChI=1S/C9H14O.C3H6O/c1-7(2)8(3)5-6-9(4)10;1-3-2-4-3/h5-7,10H,3-4H2,1-2H3;3H,2H2,1H3/b6-5-; |
| InChIKey | VKPDSSPZDPTKBE-YSMBQZINSA-N |
| XLogP | 3.23 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane?
The IUPAC name of (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane (CID 143202133) is (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane.
What is the SMILES notation for (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane?
The canonical SMILES for (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane is C=C(O)/C=C\C(=C)C(C)C.CC1CO1.
What is the InChIKey of (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane?
The InChIKey is VKPDSSPZDPTKBE-YSMBQZINSA-N. The full InChI is InChI=1S/C9H14O.C3H6O/c1-7(2)8(3)5-6-9(4)10;1-3-2-4-3/h5-7,10H,3-4H2,1-2H3;3H,2H2,1H3/b6-5-;.
What are the key properties of (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane?
(3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane has a molecular weight of 196.29 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-methyl-5-methylidenehepta-1,3-dien-2-ol;2-methyloxirane is sourced from PubChem (CID 143202133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).