About (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene
(2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene (PubChem CID 143202369) has the molecular formula C7H8ClNO
and a molecular weight of 157.60 g/mol. Its IUPAC name is (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene |
| PubChem CID | 143202369 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene |
| SMILES | C/C(Cl)=C\C=C(/C)N=C=O |
| InChI | InChI=1S/C7H8ClNO/c1-6(8)3-4-7(2)9-5-10/h3-4H,1-2H3/b6-3+,7-4+ |
| InChIKey | QAHUBJQDBJZJQR-XOKGJFMYSA-N |
| XLogP | 2.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene?
The IUPAC name of (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene (CID 143202369) is (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene.
What is the SMILES notation for (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene?
The canonical SMILES for (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene is C/C(Cl)=C\C=C(/C)N=C=O.
What is the InChIKey of (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene?
The InChIKey is QAHUBJQDBJZJQR-XOKGJFMYSA-N. The full InChI is InChI=1S/C7H8ClNO/c1-6(8)3-4-7(2)9-5-10/h3-4H,1-2H3/b6-3+,7-4+.
What are the key properties of (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene?
(2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene has a molecular weight of 157.60 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2-chloro-5-isocyanatohexa-2,4-diene is sourced from PubChem (CID 143202369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).