About ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine
ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine (PubChem CID 143202488) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine.
Molecular Properties
| Compound Name | ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine |
| PubChem CID | 143202488 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine |
| SMILES | C=CCN1CCCC(CCCOC)C1.CC |
| InChI | InChI=1S/C12H23NO.C2H6/c1-3-8-13-9-4-6-12(11-13)7-5-10-14-2;1-2/h3,12H,1,4-11H2,2H3;1-2H3 |
| InChIKey | FMXFZTKMFPWFON-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine?
The IUPAC name of ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine (CID 143202488) is ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine.
What is the SMILES notation for ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine?
The canonical SMILES for ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine is C=CCN1CCCC(CCCOC)C1.CC.
What is the InChIKey of ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine?
The InChIKey is FMXFZTKMFPWFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.C2H6/c1-3-8-13-9-4-6-12(11-13)7-5-10-14-2;1-2/h3,12H,1,4-11H2,2H3;1-2H3.
What are the key properties of ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine?
ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine has a molecular weight of 227.39 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-methoxypropyl)-1-prop-2-enylpiperidine is sourced from PubChem (CID 143202488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).