C14H24N2O2S — CID 143203127
ethane;[3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]carbamothioic S-acid (PubChem CID 143203127) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is ethane;[3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]carbamothioic S-acid.
| Compound Name | ethane;[3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 143203127 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethane;[3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]carbamothioic S-acid |
| SMILES | CC.CNCC(O)C(Cc1ccccc1)NC(=O)S |
| InChI | InChI=1S/C12H18N2O2S.C2H6/c1-13-8-11(15)10(14-12(16)17)7-9-5-3-2-4-6-9;1-2/h2-6,10-11,13,15H,7-8H2,1H3,(H2,14,16,17);1-2H3 |
| InChIKey | LIIBRVNKVBRRIP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|