C26H28F9N5O2 — CID 143203132
ethyl 4-[(1R,2Z)-2-amino-2-[amino(methyl)hydrazinylidene]-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 143203132) has the molecular formula C26H28F9N5O2 and a molecular weight of 613.53 g/mol. Its IUPAC name is ethyl 4-[(1R,2Z)-2-amino-2-[amino(methyl)hydrazinylidene]-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 4-[(1R,2Z)-2-amino-2-[amino(methyl)hydrazinylidene]-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 143203132 |
| Molecular Formula | C26H28F9N5O2 |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | ethyl 4-[(1R,2Z)-2-amino-2-[amino(methyl)hydrazinylidene]-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(C(F)(F)F)cc2C([C@@H](/C(N)=N/N(C)N)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1CC |
| InChI | InChI=1S/C26H28F9N5O2/c1-4-17-12-19(18-11-14(24(27,28)29)6-7-20(18)40(17)23(41)42-5-2)21(22(36)38-39(3)37)13-8-15(25(30,31)32)10-16(9-13)26(33,34)35/h6-11,17,19,21H,4-5,12,37H2,1-3H3,(H2,36,38)/t17?,19?,21-/m0/s1 |
| InChIKey | UZRQELAQSQNGIK-XTXLOEGASA-N |
| XLogP | 6.83 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|