About 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane
4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane (PubChem CID 143203207) has the molecular formula C25H43FO
and a molecular weight of 378.62 g/mol. Its IUPAC name is 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane.
Molecular Properties
| Compound Name | 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane |
| PubChem CID | 143203207 |
| Molecular Formula | C25H43FO |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane |
| SMILES | CCCC(CCC)C1(O)c2cccc(F)c2CC1(C)C.CCCCCCC |
| InChI | InChI=1S/C18H27FO.C7H16/c1-5-8-13(9-6-2)18(20)15-10-7-11-16(19)14(15)12-17(18,3)4;1-3-5-7-6-4-2/h7,10-11,13,20H,5-6,8-9,12H2,1-4H3;3-7H2,1-2H3 |
| InChIKey | LYJMBUGIMAOUDS-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane?
The IUPAC name of 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane (CID 143203207) is 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane.
What is the SMILES notation for 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane?
The canonical SMILES for 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane is CCCC(CCC)C1(O)c2cccc(F)c2CC1(C)C.CCCCCCC.
What is the InChIKey of 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane?
The InChIKey is LYJMBUGIMAOUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27FO.C7H16/c1-5-8-13(9-6-2)18(20)15-10-7-11-16(19)14(15)12-17(18,3)4;1-3-5-7-6-4-2/h7,10-11,13,20H,5-6,8-9,12H2,1-4H3;3-7H2,1-2H3.
What are the key properties of 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane?
4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane has a molecular weight of 378.62 g/mol, XLogP of 7.79, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol;heptane is sourced from PubChem (CID 143203207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).