About 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol
4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol (PubChem CID 143203212) has the molecular formula C22H40OS2
and a molecular weight of 384.70 g/mol. Its IUPAC name is 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol.
Molecular Properties
| Compound Name | 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol |
| PubChem CID | 143203212 |
| Molecular Formula | C22H40OS2 |
| Molecular Weight | 384.70 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol |
| SMILES | CCCC(CCC)C1(O)c2ccsc2CC1(C)C.CCCCCCS |
| InChI | InChI=1S/C16H26OS.C6H14S/c1-5-7-12(8-6-2)16(17)13-9-10-18-14(13)11-15(16,3)4;1-2-3-4-5-6-7/h9-10,12,17H,5-8,11H2,1-4H3;7H,2-6H2,1H3 |
| InChIKey | FHGVHMPSGQBPEC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol?
The IUPAC name of 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol (CID 143203212) is 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol.
What is the SMILES notation for 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol?
The canonical SMILES for 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol is CCCC(CCC)C1(O)c2ccsc2CC1(C)C.CCCCCCS.
What is the InChIKey of 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol?
The InChIKey is FHGVHMPSGQBPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26OS.C6H14S/c1-5-7-12(8-6-2)16(17)13-9-10-18-14(13)11-15(16,3)4;1-2-3-4-5-6-7/h9-10,12,17H,5-8,11H2,1-4H3;7H,2-6H2,1H3.
What are the key properties of 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol?
4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol has a molecular weight of 384.70 g/mol, XLogP of 7.23, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-4-yl-5,5-dimethyl-6H-cyclopenta[b]thiophen-4-ol;hexane-1-thiol is sourced from PubChem (CID 143203212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).