About 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol
4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol (PubChem CID 143203236) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol.
Molecular Properties
| Compound Name | 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol |
| PubChem CID | 143203236 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol |
| SMILES | CCCC(CCC)C1(O)c2cc(C)ccc2COC1(C)C |
| InChI | InChI=1S/C19H30O2/c1-6-8-16(9-7-2)19(20)17-12-14(3)10-11-15(17)13-21-18(19,4)5/h10-12,16,20H,6-9,13H2,1-5H3 |
| InChIKey | VVJPWQWQVBSWOZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol?
The IUPAC name of 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol (CID 143203236) is 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol.
What is the SMILES notation for 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol?
The canonical SMILES for 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol is CCCC(CCC)C1(O)c2cc(C)ccc2COC1(C)C.
What is the InChIKey of 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol?
The InChIKey is VVJPWQWQVBSWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-6-8-16(9-7-2)19(20)17-12-14(3)10-11-15(17)13-21-18(19,4)5/h10-12,16,20H,6-9,13H2,1-5H3.
What are the key properties of 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol?
4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol has a molecular weight of 290.45 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-4-yl-3,3,6-trimethyl-1H-isochromen-4-ol is sourced from PubChem (CID 143203236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).