About (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite
(1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite (PubChem CID 143203282) has the molecular formula C11H9FINO2S
and a molecular weight of 365.17 g/mol. Its IUPAC name is (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite.
Molecular Properties
| Compound Name | (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite |
| PubChem CID | 143203282 |
| Molecular Formula | C11H9FINO2S |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite |
| SMILES | COc1c(F)ccc2c1C(C#N)(OSI)CC2 |
| InChI | InChI=1S/C11H9FINO2S/c1-15-10-8(12)3-2-7-4-5-11(6-14,9(7)10)16-17-13/h2-3H,4-5H2,1H3 |
| InChIKey | FEKOCSXVGBQREE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite?
The IUPAC name of (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite (CID 143203282) is (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite.
What is the SMILES notation for (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite?
The canonical SMILES for (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite is COc1c(F)ccc2c1C(C#N)(OSI)CC2.
What is the InChIKey of (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite?
The InChIKey is FEKOCSXVGBQREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FINO2S/c1-15-10-8(12)3-2-7-4-5-11(6-14,9(7)10)16-17-13/h2-3H,4-5H2,1H3.
What are the key properties of (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite?
(1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite has a molecular weight of 365.17 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-6-fluoro-7-methoxy-2,3-dihydroinden-1-yl)oxy thiohypoiodite is sourced from PubChem (CID 143203282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).