About 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol
4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol (PubChem CID 143203335) has the molecular formula C18H25Br2FO
and a molecular weight of 436.20 g/mol. Its IUPAC name is 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol.
Molecular Properties
| Compound Name | 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol |
| PubChem CID | 143203335 |
| Molecular Formula | C18H25Br2FO |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol |
| SMILES | CCCC(CCC)C1(O)c2c(Br)c(F)cc(Br)c2CC1(C)C |
| InChI | InChI=1S/C18H25Br2FO/c1-5-7-11(8-6-2)18(22)15-12(10-17(18,3)4)13(19)9-14(21)16(15)20/h9,11,22H,5-8,10H2,1-4H3 |
| InChIKey | FSNFONSIPDKTTC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol?
The IUPAC name of 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol (CID 143203335) is 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol.
What is the SMILES notation for 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol?
The canonical SMILES for 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol is CCCC(CCC)C1(O)c2c(Br)c(F)cc(Br)c2CC1(C)C.
What is the InChIKey of 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol?
The InChIKey is FSNFONSIPDKTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Br2FO/c1-5-7-11(8-6-2)18(22)15-12(10-17(18,3)4)13(19)9-14(21)16(15)20/h9,11,22H,5-8,10H2,1-4H3.
What are the key properties of 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol?
4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol has a molecular weight of 436.20 g/mol, XLogP of 6.34, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibromo-6-fluoro-1-heptan-4-yl-2,2-dimethyl-3H-inden-1-ol is sourced from PubChem (CID 143203335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).