C17H22S6 — CID 143203352
benzene-1,2-dithiol;2,3-dihydro-1,4-benzodithiine-2,3-dithiol;propane (PubChem CID 143203352) has the molecular formula C17H22S6 and a molecular weight of 418.77 g/mol. Its IUPAC name is benzene-1,2-dithiol;2,3-dihydro-1,4-benzodithiine-2,3-dithiol;propane.
| Compound Name | benzene-1,2-dithiol;2,3-dihydro-1,4-benzodithiine-2,3-dithiol;propane |
|---|---|
| PubChem CID | 143203352 |
| Molecular Formula | C17H22S6 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | benzene-1,2-dithiol;2,3-dihydro-1,4-benzodithiine-2,3-dithiol;propane |
| SMILES | CCC.SC1Sc2ccccc2SC1S.Sc1ccccc1S |
| InChI | InChI=1S/C8H8S4.C6H6S2.C3H8/c9-7-8(10)12-6-4-2-1-3-5(6)11-7;7-5-3-1-2-4-6(5)8;1-3-2/h1-4,7-10H;1-4,7-8H;3H2,1-2H3 |
| InChIKey | DQNWRLBROJVOTM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|