C17H18S6 — CID 143203353
2,3-bis(thiiran-2-ylmethylsulfanyl)-3,8-dihydro-2H-cyclopenta[g][1,4]benzodithiine (PubChem CID 143203353) has the molecular formula C17H18S6 and a molecular weight of 414.73 g/mol. Its IUPAC name is 2,3-bis(thiiran-2-ylmethylsulfanyl)-3,8-dihydro-2H-cyclopenta[g][1,4]benzodithiine.
| Compound Name | 2,3-bis(thiiran-2-ylmethylsulfanyl)-3,8-dihydro-2H-cyclopenta[g][1,4]benzodithiine |
|---|---|
| PubChem CID | 143203353 |
| Molecular Formula | C17H18S6 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2,3-bis(thiiran-2-ylmethylsulfanyl)-3,8-dihydro-2H-cyclopenta[g][1,4]benzodithiine |
| SMILES | C1=Cc2cc3c(cc2C1)SC(SCC1CS1)C(SCC1CS1)S3 |
| InChI | InChI=1S/C17H18S6/c1-2-10-4-14-15(5-11(10)3-1)23-17(21-9-13-7-19-13)16(22-14)20-8-12-6-18-12/h1-2,4-5,12-13,16-17H,3,6-9H2 |
| InChIKey | ULZVGHACNVUDAJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|