C18H27N5 — CID 143204563
(Z)-4-(4-aminophenyl)-1-N-[(methylideneamino)methyl]but-3-ene-1,2,4-triamine;(3Z)-hexa-1,3,5-triene (PubChem CID 143204563) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is (Z)-4-(4-aminophenyl)-1-N-[(methylideneamino)methyl]but-3-ene-1,2,4-triamine;(3Z)-hexa-1,3,5-triene.
| Compound Name | (Z)-4-(4-aminophenyl)-1-N-[(methylideneamino)methyl]but-3-ene-1,2,4-triamine;(3Z)-hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143204563 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (Z)-4-(4-aminophenyl)-1-N-[(methylideneamino)methyl]but-3-ene-1,2,4-triamine;(3Z)-hexa-1,3,5-triene |
| SMILES | C=C/C=C\C=C.C=NCNCC(N)/C=C(\N)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H19N5.C6H8/c1-16-8-17-7-11(14)6-12(15)9-2-4-10(13)5-3-9;1-3-5-6-4-2/h2-6,11,17H,1,7-8,13-15H2;3-6H,1-2H2/b12-6-;6-5- |
| InChIKey | PLMUGUIVBIYSBH-JAFDBPJCSA-N |
| XLogP | 2.06 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|