C16H18O — CID 143204577
4-[(1E,3E,7Z)-6-methylidenenona-1,3,7-trienyl]phenol (PubChem CID 143204577) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-[(1E,3E,7Z)-6-methylidenenona-1,3,7-trienyl]phenol.
| Compound Name | 4-[(1E,3E,7Z)-6-methylidenenona-1,3,7-trienyl]phenol |
|---|---|
| PubChem CID | 143204577 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-[(1E,3E,7Z)-6-methylidenenona-1,3,7-trienyl]phenol |
| SMILES | C=C(/C=C\C)C/C=C/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H18O/c1-3-7-14(2)8-5-4-6-9-15-10-12-16(17)13-11-15/h3-7,9-13,17H,2,8H2,1H3/b5-4+,7-3-,9-6+ |
| InChIKey | UDWNHZWXBHIPRZ-JRTWIHGQSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|