C22H18FN3O2S — CID 143204661
2-[3-ethynyl-1-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazolidin-4-one (PubChem CID 143204661) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[3-ethynyl-1-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[3-ethynyl-1-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143204661 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[3-ethynyl-1-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazolidin-4-one |
| SMILES | C#Cc1nn(-c2ccc(F)cc2)cc1C1SCC(=O)N1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C22H18FN3O2S/c1-2-20-19(13-26(24-20)17-7-5-16(23)6-8-17)22-25(21(28)14-29-22)12-11-15-3-9-18(27)10-4-15/h1,3-10,13,22,27H,11-12,14H2 |
| InChIKey | ORAARKSLYHIJQK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|