About ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine
ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine (PubChem CID 143204904) has the molecular formula C19H38N2
and a molecular weight of 294.53 g/mol. Its IUPAC name is ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine.
Molecular Properties
| Compound Name | ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine |
| PubChem CID | 143204904 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine |
| SMILES | CC.CC.CCC(CCC1(C)CCCN1)C1=CCCN=C1 |
| InChI | InChI=1S/C15H26N2.2C2H6/c1-3-13(14-6-4-10-16-12-14)7-9-15(2)8-5-11-17-15;2*1-2/h6,12-13,17H,3-5,7-11H2,1-2H3;2*1-2H3 |
| InChIKey | OICMEUMHDJMATE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine?
The IUPAC name of ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine (CID 143204904) is ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine.
What is the SMILES notation for ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine?
The canonical SMILES for ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine is CC.CC.CCC(CCC1(C)CCCN1)C1=CCCN=C1.
What is the InChIKey of ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine?
The InChIKey is OICMEUMHDJMATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2.2C2H6/c1-3-13(14-6-4-10-16-12-14)7-9-15(2)8-5-11-17-15;2*1-2/h6,12-13,17H,3-5,7-11H2,1-2H3;2*1-2H3.
What are the key properties of ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine?
ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine has a molecular weight of 294.53 g/mol, XLogP of 5.39, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-[1-(2-methylpyrrolidin-2-yl)pentan-3-yl]-2,3-dihydropyridine is sourced from PubChem (CID 143204904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).