C12H10O5 — CID 143205288
5-(2,2-dihydroxypropanoyl)-1-benzofuran-6-carbaldehyde (PubChem CID 143205288) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-(2,2-dihydroxypropanoyl)-1-benzofuran-6-carbaldehyde.
| Compound Name | 5-(2,2-dihydroxypropanoyl)-1-benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 143205288 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 5-(2,2-dihydroxypropanoyl)-1-benzofuran-6-carbaldehyde |
| SMILES | CC(O)(O)C(=O)c1cc2ccoc2cc1C=O |
| InChI | InChI=1S/C12H10O5/c1-12(15,16)11(14)9-4-7-2-3-17-10(7)5-8(9)6-13/h2-6,15-16H,1H3 |
| InChIKey | KKCYPYJUXBAZQJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|