About 5,6-diacetylisoindole-1,3-dione
5,6-diacetylisoindole-1,3-dione (PubChem CID 143205318) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is 5,6-diacetylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 5,6-diacetylisoindole-1,3-dione |
| PubChem CID | 143205318 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 5,6-diacetylisoindole-1,3-dione |
| SMILES | CC(=O)c1cc2c(cc1C(C)=O)C(=O)NC2=O |
| InChI | InChI=1S/C12H9NO4/c1-5(14)7-3-9-10(4-8(7)6(2)15)12(17)13-11(9)16/h3-4H,1-2H3,(H,13,16,17) |
| InChIKey | PPBHKXQEPACMAZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diacetylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diacetylisoindole-1,3-dione?
The IUPAC name of 5,6-diacetylisoindole-1,3-dione (CID 143205318) is 5,6-diacetylisoindole-1,3-dione.
What is the SMILES notation for 5,6-diacetylisoindole-1,3-dione?
The canonical SMILES for 5,6-diacetylisoindole-1,3-dione is CC(=O)c1cc2c(cc1C(C)=O)C(=O)NC2=O.
What is the InChIKey of 5,6-diacetylisoindole-1,3-dione?
The InChIKey is PPBHKXQEPACMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c1-5(14)7-3-9-10(4-8(7)6(2)15)12(17)13-11(9)16/h3-4H,1-2H3,(H,13,16,17).
What are the key properties of 5,6-diacetylisoindole-1,3-dione?
5,6-diacetylisoindole-1,3-dione has a molecular weight of 231.21 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diacetylisoindole-1,3-dione is sourced from PubChem (CID 143205318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).