C26H34BrN3O3 — CID 143205917
3-[4-[(15Z)-6-bromo-2-oxa-10-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,12,15-heptaen-9-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid;ethane (PubChem CID 143205917) has the molecular formula C26H34BrN3O3 and a molecular weight of 516.48 g/mol. Its IUPAC name is 3-[4-[(15Z)-6-bromo-2-oxa-10-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,12,15-heptaen-9-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid;ethane.
| Compound Name | 3-[4-[(15Z)-6-bromo-2-oxa-10-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,12,15-heptaen-9-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid;ethane |
|---|---|
| PubChem CID | 143205917 |
| Molecular Formula | C26H34BrN3O3 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-[4-[(15Z)-6-bromo-2-oxa-10-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,12,15-heptaen-9-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid;ethane |
| SMILES | CC.CC(C)(CN1CCN(C2=NC3=C(C/C=C\CC=C3)Oc3ccc(Br)cc32)CC1)C(=O)O |
| InChI | InChI=1S/C24H28BrN3O3.C2H6/c1-24(2,23(29)30)16-27-11-13-28(14-12-27)22-18-15-17(25)9-10-20(18)31-21-8-6-4-3-5-7-19(21)26-22;1-2/h4-7,9-10,15H,3,8,11-14,16H2,1-2H3,(H,29,30);1-2H3/b6-4-,7-5?; |
| InChIKey | QMABUTNPBKLWAM-UCMFYHICSA-N |
| XLogP | 5.46 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|