About 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione
1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione (PubChem CID 143206094) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione |
| PubChem CID | 143206094 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CCC1=O.CN1CCC(O)CC1 |
| InChI | InChI=1S/C6H13NO.C5H7NO2/c1-7-4-2-6(8)3-5-7;1-6-4(7)2-3-5(6)8/h6,8H,2-5H2,1H3;2-3H2,1H3 |
| InChIKey | LHVRZQUTBNSIJA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione?
The IUPAC name of 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione (CID 143206094) is 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione.
What is the SMILES notation for 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione?
The canonical SMILES for 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione is CN1C(=O)CCC1=O.CN1CCC(O)CC1.
What is the InChIKey of 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione?
The InChIKey is LHVRZQUTBNSIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C5H7NO2/c1-7-4-2-6(8)3-5-7;1-6-4(7)2-3-5(6)8/h6,8H,2-5H2,1H3;2-3H2,1H3.
What are the key properties of 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione?
1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione has a molecular weight of 228.29 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-ol;1-methylpyrrolidine-2,5-dione is sourced from PubChem (CID 143206094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).