C9H14FNO — CID 143206210
(3E,5E)-4-fluoro-5-methoxy-N-methylhepta-1,3,5-trien-2-amine (PubChem CID 143206210) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is (3E,5E)-4-fluoro-5-methoxy-N-methylhepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5E)-4-fluoro-5-methoxy-N-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143206210 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (3E,5E)-4-fluoro-5-methoxy-N-methylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C(F)\C(=C/C)OC)NC |
| InChI | InChI=1S/C9H14FNO/c1-5-9(12-4)8(10)6-7(2)11-3/h5-6,11H,2H2,1,3-4H3/b8-6+,9-5+ |
| InChIKey | NAHCQENCNJTBTN-RFSWUZDDSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|