C25H38O5 — CID 143206807
(3S)-6-[(3R,7S)-3,7-dimethyl-1-[(2S)-2-methylbutanoyl]oxyspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,2'-cyclopropane]-1'-yl]-3-hydroxyhexanoic acid (PubChem CID 143206807) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (3S)-6-[(3R,7S)-3,7-dimethyl-1-[(2S)-2-methylbutanoyl]oxyspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,2'-cyclopropane]-1'-yl]-3-hydroxyhexanoic acid.
| Compound Name | (3S)-6-[(3R,7S)-3,7-dimethyl-1-[(2S)-2-methylbutanoyl]oxyspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,2'-cyclopropane]-1'-yl]-3-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 143206807 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (3S)-6-[(3R,7S)-3,7-dimethyl-1-[(2S)-2-methylbutanoyl]oxyspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,2'-cyclopropane]-1'-yl]-3-hydroxyhexanoic acid |
| SMILES | CC[C@H](C)C(=O)OC1C[C@@H](C)C=C2C=C[C@H](C)C3(CC3CCC[C@H](O)CC(=O)O)C21 |
| InChI | InChI=1S/C25H38O5/c1-5-16(3)24(29)30-21-12-15(2)11-18-10-9-17(4)25(23(18)21)14-19(25)7-6-8-20(26)13-22(27)28/h9-11,15-17,19-21,23,26H,5-8,12-14H2,1-4H3,(H,27,28)/t15-,16-,17-,19?,20-,21?,23?,25?/m0/s1 |
| InChIKey | GCFLCELZXYRAHB-PFDQOBEPSA-N |
| XLogP | 4.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |