C30H28F3N7O4 — CID 143206973
N-[6-[3-ethyl-4-[[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]pyridine-3-carboxamide (PubChem CID 143206973) has the molecular formula C30H28F3N7O4 and a molecular weight of 607.59 g/mol. Its IUPAC name is N-[6-[3-ethyl-4-[[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-[3-ethyl-4-[[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143206973 |
| Molecular Formula | C30H28F3N7O4 |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | N-[6-[3-ethyl-4-[[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]pyridine-3-carboxamide |
| SMILES | CCc1cc(Oc2cc(NC(=O)c3cccnc3)ncn2)ccc1NC(=O)Nc1ccc(N2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H28F3N7O4/c1-2-19-14-22(44-27-16-26(35-18-36-27)39-28(41)20-4-3-9-34-17-20)6-7-24(19)38-29(42)37-21-5-8-25(23(15-21)30(31,32)33)40-10-12-43-13-11-40/h3-9,14-18H,2,10-13H2,1H3,(H2,37,38,42)(H,35,36,39,41) |
| InChIKey | SKLQMPLZNINLBB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|