About (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde
(4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 143207421) has the molecular formula C7H6N2O3
and a molecular weight of 166.14 g/mol. Its IUPAC name is (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 143207421 |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | [H]/N=C1\C=C(C=O)C=C\C1=N\OO |
| InChI | InChI=1S/C7H6N2O3/c8-6-3-5(4-10)1-2-7(6)9-12-11/h1-4,8,11H/b8-6+,9-7- |
| InChIKey | IGLCRMUCVNGJFC-FFELTBSMSA-N |
| XLogP | 0.55 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde (CID 143207421) is (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde is [H]/N=C1\C=C(C=O)C=C\C1=N\OO.
What is the InChIKey of (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is IGLCRMUCVNGJFC-FFELTBSMSA-N. The full InChI is InChI=1S/C7H6N2O3/c8-6-3-5(4-10)1-2-7(6)9-12-11/h1-4,8,11H/b8-6+,9-7-.
What are the key properties of (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde?
(4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 166.14 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydroperoxyimino-3-iminocyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 143207421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).