C24H22F3N7OS2 — CID 143208147
1-[5-[2-[[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 143208147) has the molecular formula C24H22F3N7OS2 and a molecular weight of 545.62 g/mol. Its IUPAC name is 1-[5-[2-[[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[2-[[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 143208147 |
| Molecular Formula | C24H22F3N7OS2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[5-[2-[[6-(1,2,3,6-tetrahydropyridin-4-yl)thieno[3,2-d]pyrimidin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ncc(CCNc2ncnc3cc(C4=CCNCC4)sc23)s1 |
| InChI | InChI=1S/C24H22F3N7OS2/c25-24(26,27)15-2-1-3-16(10-15)33-22(35)34-23-30-12-17(36-23)6-9-29-21-20-18(31-13-32-21)11-19(37-20)14-4-7-28-8-5-14/h1-4,10-13,28H,5-9H2,(H,29,31,32)(H2,30,33,34,35) |
| InChIKey | QNFDGHROLCTTNO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |