About [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol
[(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol (PubChem CID 14320850) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol |
| PubChem CID | 14320850 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol |
| SMILES | OC[C@H]1CCC[C@@H]1CO |
| InChI | InChI=1S/C7H14O2/c8-4-6-2-1-3-7(6)5-9/h6-9H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | NXKFMUFJMLNJOB-RNFRBKRXSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol?
The IUPAC name of [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol (CID 14320850) is [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol.
What is the SMILES notation for [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol?
The canonical SMILES for [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol is OC[C@H]1CCC[C@@H]1CO.
What is the InChIKey of [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol?
The InChIKey is NXKFMUFJMLNJOB-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H14O2/c8-4-6-2-1-3-7(6)5-9/h6-9H,1-5H2/t6-,7-/m1/s1.
What are the key properties of [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol?
[(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol has a molecular weight of 130.19 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-(hydroxymethyl)cyclopentyl]methanol is sourced from PubChem (CID 14320850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).