About (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride
(2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride (PubChem CID 143208579) has the molecular formula C8H7ClF2O
and a molecular weight of 192.59 g/mol. Its IUPAC name is (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride.
Molecular Properties
| Compound Name | (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride |
| PubChem CID | 143208579 |
| Molecular Formula | C8H7ClF2O |
| Molecular Weight | 192.59 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride |
| SMILES | C=C(F)/C=C(\C=C(/C)F)C(=O)Cl |
| InChI | InChI=1S/C8H7ClF2O/c1-5(10)3-7(8(9)12)4-6(2)11/h3-4H,1H2,2H3/b6-4+,7-3+ |
| InChIKey | UFYNCMLFNHTOFO-DVFLZCIWSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride?
The IUPAC name of (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride (CID 143208579) is (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride.
What is the SMILES notation for (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride?
The canonical SMILES for (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride is C=C(F)/C=C(\C=C(/C)F)C(=O)Cl.
What is the InChIKey of (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride?
The InChIKey is UFYNCMLFNHTOFO-DVFLZCIWSA-N. The full InChI is InChI=1S/C8H7ClF2O/c1-5(10)3-7(8(9)12)4-6(2)11/h3-4H,1H2,2H3/b6-4+,7-3+.
What are the key properties of (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride?
(2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride has a molecular weight of 192.59 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-fluoro-2-[(E)-2-fluoroprop-1-enyl]penta-2,4-dienoyl chloride is sourced from PubChem (CID 143208579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).