C19H29N3 — CID 143209396
benzene-1,2-diamine;6-ethyl-9-methyl-2,3,4,6,7,8-hexahydro-1H-cyclohepta[b]pyridine (PubChem CID 143209396) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is benzene-1,2-diamine;6-ethyl-9-methyl-2,3,4,6,7,8-hexahydro-1H-cyclohepta[b]pyridine.
| Compound Name | benzene-1,2-diamine;6-ethyl-9-methyl-2,3,4,6,7,8-hexahydro-1H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 143209396 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | benzene-1,2-diamine;6-ethyl-9-methyl-2,3,4,6,7,8-hexahydro-1H-cyclohepta[b]pyridine |
| SMILES | CCC1C=C2CCCNC2=C(C)CC1.Nc1ccccc1N |
| InChI | InChI=1S/C13H21N.C6H8N2/c1-3-11-7-6-10(2)13-12(9-11)5-4-8-14-13;7-5-3-1-2-4-6(5)8/h9,11,14H,3-8H2,1-2H3;1-4H,7-8H2 |
| InChIKey | JUCDQKKZGBDYIR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|